| Identification | |
| Name: | 2,4-Dimethylbenzyl acetate |
| Synonyms: | 2,4-dimethylbenzyl acetate;2,4-Dimethylbenzylacetat;TUFUROLACETAT, IFF;Acetic acid 2,4-dimethylbenzyl ester;2,4-Dimethylbenzenemethanol acetate;Ai3-21160;Benzenemethanol, 2,4-dimethyl-, 1-acetate;Benzenemethanol, 2,4-dimethyl-, acetate |
| CAS: | 62346-96-7 |
| EINECS: | 263-518-8 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.22766 |
| InChI: | InChI=1/C11H14O2/c1-8-4-5-11(9(2)6-8)7-13-10(3)12/h4-6H,7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 104.2°C |
| Boiling Point: | 247.3°C at 760 mmHg |
| Density: | 1.019g/cm3 |
| Refractive index: | 1.505 |
| Specification: |
2,4-Dimethylbenzyl acetate ,its cas register number is 62346-96-7. It also can be called Benzyl alcohol, 2,4-dimethyl-, acetate ; Benzenemethanol, 2,4-dimethyl-, acetate ; and 2,4-Dimethylbenzenemethanol acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 104.2°C |
| Safety Data | |
 |
|
