| Identification | |
| Name: | mannonic-delta-lactam |
| Synonyms: | mannonic-delta-lactam |
| CAS: | 62362-63-4 |
| Molecular Formula: | C6H13NO6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H13NO6/c7-2(1-8)3(9)4(10)5(11)6(12)13/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4+,5+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 335.4°C |
| Boiling Point: | 630.9°C at 760 mmHg |
| Density: | 1.662g/cm3 |
| Refractive index: | 1.613 |
| Specification: | usageEng:A potent inhibitor of rat epididymal alpha-mannosidase and of apricot ?-glucosidase. |
| Flash Point: | 335.4°C |
| Usage: | A potent inhibitor of rat epididymal alpha-mannosidase and of apricot ?-glucosidase. |
| Safety Data | |
 |
|
