Identification |
Name: | 1,4-Diiodobenzene |
Synonyms: | 1,4-Diiobenzene;Benzene, p-diiodo- (8CI);Benzene, 1,4-diiodo-;p-Benzene diiodide;p-Diiodobenzene;Benzene, p-diiodo-; |
CAS: | 624-38-4 |
EINECS: | 210-842-2 |
Molecular Formula: | C6H4I2 |
Molecular Weight: | 329.91 |
InChI: | InChI=1/C6H4I2/c7-5-1-2-6(8)4-3-5/h1-4H |
Molecular Structure: |
 |
Properties |
Density: | 2.469 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.707 |
Solubility: | Insoluble |
Appearance: | white to light yellow crystal powder |
HS Code: | 29036990 |
Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Light Sensitive |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |