| Identification |
| Name: | 1,4-Diiodobenzene |
| Synonyms: | 1,4-Diiobenzene;Benzene, p-diiodo- (8CI);Benzene, 1,4-diiodo-;p-Benzene diiodide;p-Diiodobenzene;Benzene, p-diiodo-; |
| CAS: | 624-38-4 |
| EINECS: | 210-842-2 |
| Molecular Formula: | C6H4I2 |
| Molecular Weight: | 329.91 |
| InChI: | InChI=1/C6H4I2/c7-5-1-2-6(8)4-3-5/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Density: | 2.469 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.707 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| HS Code: | 29036990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
