| Identification |
| Name: | 1-Butanol, 2-methyl-,1-acetate |
| Synonyms: | 1-Butanol,2-methyl-, acetate (6CI,7CI,8CI,9CI);2-Methyl-1-butyl acetate;2-Methylbutylacetate; |
| CAS: | 624-41-9 |
| EINECS: | 210-843-8 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-4-6(2)5-9-7(3)8/h6H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1104 |
| Flash Point: | 95? |
| Density: | 0.876 |
| Refractive index: | 1.401 |
| Solubility: | Slightly soluble |
| Appearance: | colorless to light yellow liquid. |
| Packinggroup: | III |
| Flash Point: | 95? |
| Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. Store in a cool dry place. |
| Safety Data |
| |
 |
