| Identification |
| Name: | Pentanoic acid, 4-oxo-,methyl ester |
| Synonyms: | Levulinicacid, methyl ester (6CI,7CI,8CI); 4-Oxopentanoic acid methyl ester; Methyl4-oxopentanoate; Methyl 4-oxovalerate; Methyl levulate; Methyl levulinate;Methyl b-acetylpropionate; NSC 24874 |
| CAS: | 624-45-3 |
| EINECS: | 210-846-4 |
| Molecular Formula: | C6H10 O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-5(7)3-4-6(8)9-2/h3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -24 |
| Flash Point: | 72°C |
| Density: | 1.051 |
| Stability: | Decomposition will not occur if used and stored according to specifications. Keep away from heat and light. |
| Refractive index: | 1.422 |
| Solubility: | Very soluble |
| Appearance: | Colorless liquid with a pleasant odor. |
| Flash Point: | 72°C |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry place in tightly closed containers. |
| Safety Data |
| |
 |
