| Identification | |
| Name: | Dimethyl fumarate |
| Synonyms: | 2-Butenedioic acid (E)-, dimethyl ester;Fumaric acid, dimethyl ester (6CI,8CI);(2E)-2-Butenedioic acid dimethyl ester;(E)-But-2-enedioic acid dimethyl ester;AZL-O 211089;Dimethyl (E)-2-butenedioate;Dimethyl(E)-butenedioate;2-Butenedioic acid(2E)-, 1,4-dimethyl ester;Dimethyl trans-ethylenedicarboxylate;NSC 167432;trans-1,2-Ethylenedicarboxylic aciddimethyl ester;trans-Butenedioic acid dimethyl ester; |
| CAS: | 624-49-7 |
| EINECS: | 210-849-0 |
| Molecular Formula: | C6H8O4 |
| Molecular Weight: | 144.13 |
| InChI: | InChI=1/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.124 g/cm3 |
| Stability: | Stable. Incompatible with acids, bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.4037 (110.7 C) |
| Solubility: | Soluble |
| Appearance: | fine white crystalline powder |
| Specification: |
Dimethyl fumarate (CAS NO.624-49-7) is also named as 2-Butenedioic acid, dimethyl ester, (E)- ; 4-02-00-02205 (Beilstein Handbook Reference) ; AI3-07872 ; Allomaleic acid dimethyl ester ; BG 00012 ; BG 12 compound ; BG-00012 ; BG00012 ; BRN 0774590 ; Boletic acid dimethyl ester ; Dimethyl trans-ethylenedicarboxylate ; Dimethylester kyseliny fumarove ; Dimethylester kyseliny fumarove [Czech] ; Dimethylfumarate ; Ethylene, 1,2-bis(methoxycarbonyl)-, trans- ; FAG 201 ; FAG201 ; Fumaderm ; Fumaric acid, dimethyl ester ; Methyl fumarate ; NSC 167432 ; NSC 25942 ; TL 353 ; UNII-FO2303MNI2 ; trans-1,2-Ethylenedicarboxylic acid dimethyl ester ; trans-Butenedioic acid dimethyl ester . Dimethyl fumarate (CAS NO.624-49-7) is fine white crystalline powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29171990 |
| Storage Temperature: | Store at RT. |
| Color: | Crystals |
| Usage: | Used to treat psoriasis. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
