| Identification | |
| Name: | 1-Adamantaneethanol |
| Synonyms: | 1-Adamantaneethanol(8CI);1-(2-Hydroxyethyl)adamantane;2-(1-Adamantyl)-1-ethanol;2-(1-Adamantyl)ethanol;2-(1-Adamantyl)ethylalcohol;2-(Adamantan-1-yl)ethanol; |
| CAS: | 6240-11-5 |
| EINECS: | 228-353-8 |
| Molecular Formula: | C12H20O |
| Molecular Weight: | 180.29 |
| InChI: | InChI=1/C12H20O/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,1-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.065 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, acid halides. |
| Refractive index: | 1.538 |
| Appearance: | white crystalline powder |
| Specification: |
1-Adamantaneethanol , its CAS NO. is 6240-11-5, the synonyms are 2-(Tricyclo(3.3.1.1'3,7)dec-1-yl)ethanol ; 1-(2-Hydroxyethyl)adamantane . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
