| Identification | |
| Name: | polycysteine |
| Synonyms: | polycysteine |
| CAS: | 62488-11-3 |
| Molecular Formula: | C3H7NO2S |
| Molecular Weight: | 121.15818 |
| InChI: | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 240 deg C decomposes |
| Solubility: | Freely sol in alcohol, acetic acid, ammonia water; insol in ether, acetone, ethyl acetate, benzene, carbon disulfide, carbon tetrachloride Solubility (per g/100 g H2O): 28 g/100 ml of soln at 25 deg C; 16 g/100 ml of soln at 20 deg C |
| Color: | Colorless crystals White crystals |
| Safety Data | |
 |
|
