| Identification |
| Name: | Isobutyl cyanide |
| Synonyms: | 3-Methylbutanenitrile; Isovaleronitrile; |
| CAS: | 625-28-5 |
| EINECS: | 210-884-1 |
| Molecular Formula: | C5H9N |
| Molecular Weight: | 83.13 |
| InChI: | InChI=1/C5H9N/c1-5(2)3-4-6/h5H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1992 |
| Melting Point: | -101 |
| Flash Point: | 83? |
| Density: | 0.795 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.393 |
| Solubility: | Soluble |
| Packinggroup: | III |
| Flash Point: | 83? |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Synthesis of other chemicals. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
