| Identification | |
| Name: | 3-Penten-2-one |
| Synonyms: | 2-Oxo-3-pentene;2-Penten-4-one; Ethylideneacetone; Methyl 1-propenyl ketone; Methyl propenylketone; NSC 61468 |
| CAS: | 625-33-2 |
| EINECS: | 210-888-3 |
| Molecular Formula: | C5H8 O |
| Molecular Weight: | 84.11642 |
| InChI: | InChI=1S/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Density: | 119 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing and strong reducing agents, strong acids, strong bases. |
| Refractive index: | 1.437 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | colourless liquid with a pungent odour |
| Specification: |
3-Penten-2-one (625-33-2) is colourless liquid with a pungent odour. It is also called for 2-Oxo-3-pentene ; 3-01-00-02985 (Beilstein Handbook Reference) ; AI3-37794 ; Ethylidene acetone ; FEMA No. 3417 ; Methyl 1-propenyl ketone ; Methyl propenyl ketone ; NSC 61468 . |
| Report: |
Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
