| Identification | |
| Name: | ethyl-2-thiourea |
| Synonyms: | Thiourea,ethyl- (9CI); Urea, 1-ethyl-2-thio- (6CI,7CI,8CI); 1-Ethyl-2-thiourea;1-Ethylthiourea; ENT 61326; Ethylthiourea; N-Ethylthiocarbamide;N-Ethylthiourea; NSC 62921 |
| CAS: | 625-53-6 |
| EINECS: | 210-899-3 |
| Molecular Formula: | C3H8N2S |
| Molecular Weight: | 104.176 |
| InChI: | InChI=1/C3H8N2S/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 108-110 °C(lit.) |
| Density: | 1.182g/cm3 |
| Refractive index: | 1.524 |
| Specification: |
N-Ethylthiourea ,its cas register number is 625-53-6. It also can be called Thiourea, ethyl- ; Thiourea, N-ethyl- ; Urea, 1-ethyl-2-thio- ; and Ethyl-2-thiourea . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Biological Activity: | Potent, selective and reversible inhibitor of isoform II NO synthase (IC 50 = 13 nM; approximately 20- and 30-fold selective over isoforms I and III respectively). |
| Storage Temperature: | Store at RT |
| Safety Data | |
 |
|
