| Identification | |
| Name: | 2,4-Pentanediol |
| Synonyms: | 2,4-Amyleneglycol; 2,4-Dihydroxypentane; NSC 13528; NSC 53505 |
| CAS: | 625-69-4 |
| EINECS: | 210-907-5 |
| Molecular Formula: | C5H12 O2 |
| Molecular Weight: | 104.1476 |
| InChI: | InChI=1S/C5H12O2/c1-4(6)3-5(2)7/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.974 g/cm3 |
| Refractive index: | n20/D 1.435(lit.) |
| Appearance: | Appearance: clear, colourless to slightly yellowish liquid |
| Specification: |
2,4-Pentanediol is clear colorless to light yellow liquid with CAS Registry Number of 625-69-4. It is incompatible with reducing agents, acid chlorides, acid anhydrides, chloroformates. When heated to decomposition, it yields Carbon monoxide, Carbon dioxide . 2,4-Pentanediol is known as 2,4-Amylene glycol ; 2,4-Amyleneglycol ; AI3-11547 ; Isoamylene alcohol ; NSC 13528 ; NSC 53505 ; Pentanediol-2,4 ; Pentane-2,4-diol . |
| Sensitive: | Hygroscopic |
| Safety Data | |
 |
|
