| Identification | |
| Name: | 2,2'-thiodipropane |
| Synonyms: | Diisopropyl sulfide; 2,2'-Thiobispropane |
| CAS: | 625-80-9 |
| EINECS: | 210-911-7 |
| Molecular Formula: | C6H14S |
| Molecular Weight: | 118.24 |
| InChI: | InChI=1/C6H14S/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -106 C |
| Density: | 0.814 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents, strong bases, strong reducing agents. |
| Refractive index: | 1.437-1.439 |
| Solubility: | Insoluble |
| Appearance: | liquid with a penetrating and very unpleasant odour |
| Specification: |
Propane, 2,2'-thiobis- (CAS NO.35050-55-6) is also named as 2,4-Dimethyl-3-thiapentane ; Diisopropyl sulfide ; Diisopropyl sulphide ; Isopropyl sulphide ; NSC 75121 ; Isopropyl sulfide (8CI) ; 2-(Isopropylsulfanyl)propane ; 2-(Propan-2-ylsulfanyl)propan . Propane, 2,2'-thiobis- (CAS NO.35050-55-6) is liquid with a penetrating and very unpleasant odour. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
