| Identification | |
| Name: | 3-Iodotoluene |
| Synonyms: | 3-Methyl-iodobenzene |
| CAS: | 625-95-6 |
| EINECS: | 210-918-5 |
| Molecular Formula: | C7H7I |
| Molecular Weight: | 218.04 |
| InChI: | InChI=1/C7H7I/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.698 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.604-1.606 |
| Solubility: | Insoluble |
| Appearance: | Slightly yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
