| Identification | |
| Name: | b-Alanine, N-methyl-N-pentyl-, hydrochloride (1:1) |
| Synonyms: | b-Alanine, N-methyl-N-pentyl-, hydrochloride (9CI);N-Methyl-N-pentyl-b-alanine hydrochloride;3-(N-methylpentylamino) propionic acid HCL; |
| CAS: | 625120-81-2 |
| Molecular Formula: | C9H20ClNO2 |
| Molecular Weight: | 209.71 |
| InChI: | InChI=1/C9H19NO2.ClH/c1-3-4-5-8(2)10-7-6-9(11)12;/h8,10H,3-7H2,1-2H3,(H,11,12);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.8 °C |
| Boiling Point: | 314.2 °Cat760mmHg |
| Specification: |
b-Alanine, N-methyl-N-pentyl-, hydrochloride (1:1) , its cas register number 625120-81-2. It also can be called 3-(N-Methylpentylamino)propionic acid hydrochloride ; beta-Alanine, N-methyl-N-pentyl-, hydrochloride (1:1) ; and N-Methyl-N-pentyl-beta-alanine hydrochloride (1:1) . |
| Flash Point: | 143.8 °C |
| Safety Data | |
 |
|
