| Identification | |
| Name: | 4-Chlorobenzyl mercaptan |
| Synonyms: | 4-Chloro-alpha-toluenethiol; 4-Chlorobenzenemethanethiol |
| CAS: | 6258-66-8 |
| EINECS: | 228-395-7 |
| Molecular Formula: | C7H7ClS |
| Molecular Weight: | 158.64848 |
| InChI: | InChI=1S/C7H7ClS/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Density: | 1.2 |
| Refractive index: | 1.5883-1.5923 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Clear, colorless liquid. With a stench. |
| Specification: | clear colorless to light yellow liquid Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
