| Identification | |
| Name: | 3-Iodoaniline |
| Synonyms: | Iodoaniline,98% |
| CAS: | 626-01-7 |
| EINECS: | 210-922-7 |
| Molecular Formula: | C6H6IN |
| Molecular Weight: | 219.02 |
| InChI: | InChI=1/C6H6IN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.82 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to light. |
| Refractive index: | 1.681-1.683 |
| Solubility: | Insoluble |
| Appearance: | Clear, brown liquid. |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Color: | clear yellow |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
