| Identification | |
| Name: | 2,4-Dihydroxypyridine |
| Synonyms: | 2,4-Pyridinediol; 3-Deazauracil; 4-Hydroxy-2-pyridone |
| CAS: | 626-03-9 |
| EINECS: | 210-924-8 |
| Molecular Formula: | C5H5NO2 |
| Molecular Weight: | 111.0987 [g/mol] |
| InChI: | InChI=1S/C5H5NO2/c7-4-1-2-6-5(8)3-4/h1-3H,(H2,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UV1146800 |
| Flash Point: | 117.6 oC |
| Boiling Point: | 270.9 oC at 760 mmHg |
| Density: | 1.379 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 6250 mg/L at 20 ºC |
| Solubility: | 6250 mg/L at 20 oC |
| Appearance: | white to yellow-beige crystals or |
| Specification: |
?2,4-Dihydroxypyridine (CAS NO.626-03-9), its Synonyms are 2(1H)-Pyridinone, 4-hydroxy- (9CI) ; 2(1H)-Pyridone, 4-hydroxy- ; 4-Hydroxy-2-pyridone ; 2,4-Pyridinediol ; 3-Deazauracil ; 4-Hydroxy-2(1H)-pyridinone . It is white to yellow-beige crystals or cryst. powder. |
| Flash Point: | 117.6 oC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | light yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
