| Identification |
| Name: | 2,6-Dibromopyridine |
| Synonyms: | - |
| CAS: | 626-05-1 |
| EINECS: | 210-926-9 |
| Molecular Formula: | C5H3Br2N |
| Molecular Weight: | 236.89 |
| InChI: | InChI=1/C5H3Br2N/c6-4-2-1-3-5(7)8-4/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 2.059 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.607 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to gray crystalline powder |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
