| Identification | |
| Name: | 1,3-Dicyanobenzene |
| Synonyms: | Isophthalonitrile(8CI);1,3-Benzodinitrile;1,3-Bis(cyano)benzene;3-Cyanobenzonitrile;Meta-dicyanobenzene;NSC 87880;m-Benzenedinitrile;m-Cyanobenzonitrile;m-Dicyanobenzene;1,3-Benzenedicarbonitrile; |
| CAS: | 626-17-5 |
| EINECS: | 210-933-7 |
| Molecular Formula: | C8H4N2 |
| Molecular Weight: | 128.13 |
| InChI: | InChI=1/C8H4N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kg in |
| Flash Point: | 143 C |
| Density: | 0.992 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.565 |
| Solubility: | Slightly soluble SOLVENT SOLUBILIT soluble in benzene, ether, hot alcohol, chloroform |
| Appearance: | white to pale yellow powder |
| Packinggroup: | III |
| HS Code: | 29269020 |
| Flash Point: | 143 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | NEEDLES FROM ALCOHOL Needle-like, colorless to white, crystalline, flaky solid. |
| Usage: | Chemical intermediate for amines like m-xylenediamine. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
