| Identification | |
| Name: | trans-Methacrifos |
| Synonyms: | METHYL (E)-3-(DIMETHOXYPHOSPHINOTHIONYLOXY)-2-METHYL-2-PROPENOATE;METHACRIFOS;DAMFIN;2-propenoicacid,3-((dimethoxyphosphinothioyl)oxy)-2-methyl-,methylester,(e;3-((dimethoxyphosphinothioyl)oxy)-2-methyl-2-propenoicacidmethylester,(e);cga20168;oms-2005;trans-methacrifos |
| CAS: | 62610-77-9 |
| EINECS: | 250-366-2 |
| Molecular Formula: | C7H13O5PS |
| Molecular Weight: | 240.21 |
| InChI: | InChI=1/C7H13O5PS/c1-6(7(8)9-2)5-12-14-13(10-3)11-4/h5H,1-4H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Flash Point: | 110.4°C |
| Boiling Point: | 258.9°C at 760 mmHg |
| Specification: | Safety Statements:36/37-60-61 36/37:Wear suitable protective clothing and gloves 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 110.4°C |
| Storage Temperature: | APPROX 4°C |
| Safety Data | |
 |
|
