| Identification | |
| Name: | Cyclopenta[c][1]benzopyran-4(1H)-one,7-(dimethylamino)-2,3-dihydro- |
| Synonyms: | 7-Dimethylaminocyclopenta[c]coumarin;Coumarin 138; NSC 315247 |
| CAS: | 62669-74-3 |
| Molecular Formula: | C14H15 N O2 |
| Molecular Weight: | 229.27 |
| InChI: | InChI=1/C14H15NO2/c1-15(2)9-6-7-11-10-4-3-5-12(10)14(16)17-13(11)8-9/h6-8H,3-5H2,1-2H3 |
| Molecular Structure: | ![(C14H15NO2) 7-Dimethylaminocyclopenta[c]coumarin;Coumarin 138; NSC 315247](https://img1.guidechem.com/chem/e/dict/85/62669-74-3.jpg) |
| Properties | |
| Flash Point: | 173.9°C |
| Boiling Point: | 426.3°C at 760 mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.615 |
| Specification: |
Coumarin 138 , its cas register number is 62669-74-3. It also can be called 7-Dimethylamino-2,3-dihydro-1H-cyclopenta[c]chromen-4-one ; 7-(Dimethylamino)-2,3-dihydrocyclopenta[c][1]benzopyran-4(1H)-one .It is a yellow to green-yellow crystals or flakes. |
| Flash Point: | 173.9°C |
| Safety Data | |
 |
|
