| Identification | |
| Name: | Ethyl N-(2-acetoxyethyl)-N-nitrosocarbamate |
| Synonyms: | 2-Acetoxyethylnitrosocarbamic acid ethyl ester;N-(2-Acetoxyethyl)-N-nitrosocarbamic acid ethyl;N-(2-Acetoxyethyl)-N-nitrosocarbamic acid ethyl ester;N-Acetoxyethyl-N-nitrosourethane |
| CAS: | 62681-13-4 |
| Molecular Formula: | C7H12N2O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H12N2O5/c1-3-13-7(11)9(8-12)4-5-14-6(2)10/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112.6°C |
| Boiling Point: | 262.6°C at 760 mmHg |
| Density: | 1.24g/cm3 |
| Refractive index: | 1.482 |
| Specification: |
Ethyl N-(2-acetoxyethyl)-N-nitrosocarbamate , its cas register number is 62681-13-4. It also can be called Ethyl N-2-acetoxyethylnitrosocarbamate ; N-(2-Acetoxyethyl)-N-nitrosocarbamic acid ethyl ester ; N-(2-Hydroxyethyl)-N-nitrosocarbamic acid ethyl ester acetate . When heated to decomposition it emits toxic fumes of NOx. And Ethyl N-(2-acetoxyethyl)-N-nitrosocarbamate (CAS NO.62681-13-4) is a kind of carcinogen. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 112.6°C |
| Safety Data | |
 |
|
