| Identification | |
| Name: | 1-(4-Nitrophenyl)piperazine |
| Synonyms: | - |
| CAS: | 6269-89-2 |
| EINECS: | 228-443-7 |
| Molecular Formula: | C10H13N3O2 |
| Molecular Weight: | 207.23 |
| InChI: | InChI=1/C10H13N3O2/c14-13(15)10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 190.8 °C |
| Boiling Point: | 391.9 °C at 760 mmHg |
| Density: | 1.222 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | yellow to ochre powder |
| Specification: |
Piperazine, 1-(4-nitrophenyl)- , with CAS number of 6269-89-2, can be called 1-(4-Nitrophenyl)piperazine ; 1-(4-Nitrophenyl)piperazin ; 1-(4-Nitrophenyl)piperazine 97% ; 1-(4-Nitro-phenyl)-piperazine . It is a yellow to ochre powder. |
| Packinggroup: | III |
| Flash Point: | 190.8 °C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
