| Identification | |
| Name: | Nitric acid, propylester |
| Synonyms: | Propylnitrate (6CI,7CI); n-Propyl nitrate |
| CAS: | 627-13-4 |
| EINECS: | 210-985-0 |
| Molecular Formula: | C3H7 N O3 |
| Molecular Weight: | 105.11 |
| InChI: | InChI=1/C3H7NO3/c1-2-3-7-4(5)6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1865 |
| Melting Point: | -100 |
| Flash Point: | 20 |
| Boiling Point: | 110.5 |
| Density: | 1.05 |
| Refractive index: | 1.402 |
| Solubility: | Soluble in alcohol and ether. In water, 3,290 mg/L @ 25 deg C [Hauff K et al; Chemosphere 37: 2599-615 (1998)] PubMed Abstract |
| Specification: |
n-Propyl nitrate ,its cas register number is 627-13-4. It also can be called Nitrate de propyle normal ; Nitric acid, propyl ester ;and Propyl nitrate . n-Propyl nitrate (CAS NO.627-13-4), range from slight to strong oxidizing agents and if mixed with reducing agents, including hydrides, sulfides and nitrides, they may begin a vigorous reaction that culminates in a detonation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 20 |
| Color: | Pale yellow liquid |
| Safety Data | |
| Hazard Symbols |
100%. TLV: 25
|
 |
|
