| Identification | |
| Name: | Fumaryl chloride |
| Synonyms: | Fumaroyl chloride; trans-2-Butenedioyl dichloride |
| CAS: | 627-63-4 |
| EINECS: | 211-005-4 |
| Molecular Formula: | C4H2Cl2O2 |
| Molecular Weight: | 152.96 |
| InChI: | InChI=1/C4H2Cl2O2/c5-3(7)1-2-4(6)8/h1-2H/b2-1+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1780 |
| Density: | 1.415 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.498-1.501 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | light yellow-green liquid |
| Specification: |
Fumaryl chloride (627-63-4) is corrosive to metals and tissue. Its vapors irritate the eyes and mucous membranes. Fumaryl chloride (627-63-4) is incompatible with strong oxidizing agents, alcohols, amines and other bases. Fumaryl chloride (627-63-4) may react vigorously or explosively if mixed with diisopropyl ether or other ethers in the presence of trace amounts of metal salts. Fumaryl chloride (627-63-4) will release flammable, toxic or corrosive gases when reacted with water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29171990 |
| Sensitive: | Moisture Sensitive |
| Usage: | Monomer. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
