| Identification | |
| Name: | p-Phenetidine antimonyl tartrate |
| Synonyms: | N-Ethyl-alpha-phenylphenethylamine hydrochloride;NSC 33648;Ethylamine, 1,2-diphenyl-N-ethyl-, hydrochloride;n-ethyl-1,2-diphenylethanamine hydrochloride(1:1);Phenethylamine, N-ethyl-alpha-phenyl-, hydrochloride;6272-97-5;AC1Q3CHF;WLN: 2MYR&1R &GH;AC1L38E3;NSC33648;AR-1K6844;NSC-33648;LS-103510;N-ethyl-1,2-diphenylethanamine hydrochloride;Ethylamine,2-diphenyl-N-ethyl-, hydrochloride;Benzeneethanamine, N-ethyl-alpha-phenyl-, hydrochloride;Benzeneethanamine, N-ethyl-alpha-phenyl-, hydrochloride (9CI) |
| CAS: | 6273-75-2 |
| Molecular Formula: | C12H16NO8Sb . H2O |
| Molecular Weight: | 674.8251 |
| InChI: | InChI=1/C8H11NO.2C4H4O6.2Sb/c1-2-10-8-5-3-7(9)4-6-8;2*5-1(3(7)8)2(6)4(9)10;;/h3-6H,2,9H2,1H3;2*1-2H,(H,7,8)(H,9,10);;/q;2*-2;2*+3/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.3°C |
| Boiling Point: | 254°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
p-Phenetidine antimonyl tartrate , its cas register number is 6273-75-2. It also can be called p-Phenetidinantimonyltartrat . When p-Phenetidine antimonyl tartrate (CAS NO.6273-75-2) heated to decomposition, it emits toxic fumes of NOx and Sb. |
| Report: |
Antimony and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 110.3°C |
| Safety Data | |
 |
|
