| Identification | |
| Name: | 2-Pyridinecarboxylicacid, 3-hydroxy-, methyl ester |
| Synonyms: | 3-Hydroxy-2-methoxycarbonylpyridine;3-Hydroxypicolinic acid methyl ester;3-Hydroxypyridine-2-carboxylic acidmethyl ester;Methyl 3-hydroxypyridine-2-carboxylate; |
| CAS: | 62733-99-7 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.13 |
| InChI: | InChI=1/C7H7NO3/c1-11-7(10)6-5(9)3-2-4-8-6/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.287 g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
The cas register number of 3-Hydroxypyridine-2-carboxylic acid methyl ester is 62733-99-7. It also can be called as 2-Pyridinecarboxylicacid, 3-hydroxy-, methyl ester and the Systematic name about this chemical is methyl 3-hydroxypyridine-2-carboxylate. It belongs to the following product categories, such as Carboxylicester, pharmacetical and so on. Physical properties about 3-Hydroxypyridine-2-carboxylic acid methyl ester are: (1)ACD/LogP: 1.19; (2)#H bond acceptors: 4; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 3; (5)Polar Surface Area: 48.42Å2; (6)Index of Refraction: 1.551; (7)Molar Refractivity: 37.99 cm3; (8)Molar Volume: 118.9 cm3; (9)Polarizability: 15.06x10-24cm3; (10)Surface Tension: 53.1 dyne/cm; (11)Enthalpy of Vaporization: 60.73 kJ/mol; (12)Boiling Point: 340.6 °C at 760 mmHg; (13)Vapour Pressure: 4.3E-05 mmHg at 25°C . You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
