| Identification | |
| Name: | Resazurin Sodium Salt |
| Synonyms: | 3H-Phenoxazin-3-one, 7-hydroxy-, 10-oxide, sodium salt;3H-Phenoxazin-3-one, 7-hydroxy-, 10-oxide, sodium salt (1:1);7-Sodiooxy-3H-phenoxazin-3-one 10-oxide; |
| CAS: | 62758-13-8 |
| EINECS: | 263-718-5 |
| Molecular Formula: | C12H6NNaO4 |
| Molecular Weight: | 251.17 |
| InChI: | InChI=1/C12H7NO4.Na/c14-7-1-3-9-11(5-7)17-12-6-8(15)2-4-10(12)13(9)16;/h1-6,14H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 242.4 ºC |
| Boiling Point: | 477.2 ºC at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | dark red crystals with a greenish lustre |
| Flash Point: | 242.4 ºC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
