| Identification | |
| Name: | Niax Catalyst Esn |
| Synonyms: | 2-(2-dimethylaminoethoxy)-N,N-dimethyl-ethanamine: 3-dimethylaminoprop anenitrile;NIAX catalyst ESN |
| CAS: | 62765-93-9 |
| Molecular Formula: | C13H30N4O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H20N2O.C5H10N2/c1-9(2)5-7-11-8-6-10(3)4;1-7(2)5-3-4-6/h5-8H2,1-4H3;3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 46.2°C |
| Boiling Point: | 194.8°C at 760 mmHg |
| Specification: |
Niax Catalyst Esn (CAS NO.62765-93-9) is a liquid mixture consisting of 95% dimethylaminopropionitrile. It sale of the material was discontinuted in1978 after its use was linked to urological disorders among workers at a number of factories manufacturing these foams.It is incompatible with the following: Oxidizers. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 46.2°C |
| Safety Data | |
 |
|
