| Identification | |
| Name: | 2H-Benzimidazol-2-one,1-(3-chloropropyl)-1,3-dihydro- |
| Synonyms: | 1-(3-Chloropropyl)-1,3-dihydro-2H-benzimidazol-2-one;1-(3-Chloropropyl)-1,3-dihydrobenzimidazol-2-one; |
| CAS: | 62780-89-6 |
| EINECS: | 263-731-6 |
| Molecular Formula: | C10H11ClN2O |
| Molecular Weight: | 210.66 |
| InChI: | InChI=1/C10H11ClN2O/c11-6-3-7-13-9-5-2-1-4-8(9)12-10(13)14/h1-2,4-5H,3,6-7H2,(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 377 |
| Density: | 1.257 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.57 |
| Solubility: | 8.3G/100ML METHANOL - 6.6G/100ML ETHANOL,4.4G/100ML 2-PROPANOL - 43.6G/100ML NN-DMF,8.1G/100ML ACETONE - 21.5G/100ML DICHLOROMETHANE |
| Appearance: | Very slightly beige powder. |
| Specification: |
2H-Benzimidazol-2-one,1-(3-chloropropyl)-1,3-dihydro- , with CAS number of 62780-89-6, can be called 3(3-Chloropropyl)-2,3-dihydro-1h-benzimidazole-2-one ; 1-(3-chloropropyl)-1,3-dihydro-2h-benzimidazol-2-one ; 1-(3-chloropropyl)-2-benzimidazolidinone ; 1-(3-chloropropyl)-1,3-dihydro-2h-benzimidezole-2-one ; timtec-bb sbb003442 ; 1-(3-chloropropyl)-1,3-dihydro-2h-benzimidazole-2-one ; balancemainlybromo ; ca90% .It is a white to slightly beige powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
