Identification |
Name: | 2,8,10-Trioxa-5-azahexadecanoicacid, 3-methyl-4,9-dioxo-, hexyl ester |
Synonyms: | Carbonicacid, hexyl ester, diester with N-(2-hydroxyethyl)lactamide (8CI);NSC 11087; |
CAS: | 6280-25-7 |
Molecular Formula: | C19H35NO7 |
Molecular Weight: | 389.4837 |
InChI: | InChI=1/C19H35NO7/c1-4-6-8-10-13-24-18(22)26-15-12-20-17(21)16(3)27-19(23)25-14-11-9-7-5-2/h16H,4-15H2,1-3H3,(H,20,21) |
Molecular Structure: |
![(C19H35NO7) Carbonicacid, hexyl ester, diester with N-(2-hydroxyethyl)lactamide (8CI);NSC 11087;](https://img1.guidechem.com/chem/e/dict/48/6280-25-7.jpg) |
Properties |
Flash Point: | 258.8°C |
Boiling Point: | 504.3°Cat760mmHg |
Density: | 1.057g/cm3 |
Refractive index: | 1.459 |
Flash Point: | 258.8°C |
Safety Data |
|
![](/images/detail_15.png) |