| Identification | |
| Name: | Methanone,(3,4-dichlorophenyl)phenyl- |
| Synonyms: | Benzophenone,3,4-dichloro- (6CI,8CI);3,4-Dichlorobenzophenone;3,4-Dichlorophenyl phenylketone;NSC 5249;Phenyl 3,4-dichlorophenyl ketone; |
| CAS: | 6284-79-3 |
| EINECS: | 228-509-5 |
| Molecular Formula: | C13H8Cl2O |
| Molecular Weight: | 251.10802 |
| InChI: | InChI=1S/C13H8Cl2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.311 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.603 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | light brown to pink-grey crystalline powde |
| Specification: | light brown to pink-grey crystalline powde Safety Statements:37/39-26-24/25 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
