| Identification | |
| Name: | Piperidine,2,4-dimethyl- |
| Synonyms: | 2,4-Lupetidine(6CI,7CI,8CI);2,4-Dimethylpiperidine;NSC 8693; |
| CAS: | 6287-19-0 |
| Molecular Formula: | C7H15N |
| Molecular Weight: | 113.2 |
| InChI: | InChI=1/C7H15N/c1-6-3-4-8-7(2)5-6/h6-8H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.794 g/cm3 |
| Refractive index: | 1.416 |
| Specification: |
The 2,4-Dimethylpiperidine with the CAS number 6287-19-0 is also called Piperidine,2,4-dimethyl-. Its molecular formula is C7H15N. The product category is Piperidine. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 2,4-Dimethylpiperidine are: (1)ACD/LogP: 1.92; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.18; (4)ACD/LogD (pH 7.4): -1.12; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 3.24 Å2; (13)Index of Refraction: 1.416; (14)Molar Refractivity: 35.82 cm3; (15)Molar Volume: 142.4 cm3; (16)Polarizability: 14.2×10-24cm3; (17)Surface Tension: 22.9 dyne/cm; (18)Enthalpy of Vaporization: 37.84 kJ/mol; (19)Vapour Pressure: 5.93 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
