Identification |
Name: | Propanoic acid,2-[(methoxycarbonyl)oxy]-, methyl ester |
Synonyms: | Carbonicacid, methyl ester, ester with methyl lactate (8CI); NSC 12057 |
CAS: | 6288-11-5 |
Molecular Formula: | C6H10 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H10O5/c1-4(5(7)9-2)11-6(8)10-3/h4H,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 65.9°C |
Boiling Point: | 180.4°C at 760 mmHg |
Density: | 1.147g/cm3 |
Refractive index: | 1.411 |
Flash Point: | 65.9°C |
Safety Data |
|
 |