| Identification | |
| Name: | Acetic acid,2-methoxy-, methyl ester |
| Synonyms: | Aceticacid, methoxy-, methyl ester (7CI,8CI,9CI);Methoxyacetic acid methyl ester;Methyl 2-methoxyacetate;Methyl methoxyacetate;Methyl a-methoxyacetate;NSC 61447;NSC6701; |
| CAS: | 6290-49-9 |
| EINECS: | 228-539-9 |
| Molecular Formula: | C4H8O3 |
| Molecular Weight: | 104.1 |
| InChI: | InChI=1/C4H8O3/c1-6-3-4(5)7-2/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 1.05 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.3954-1.3974 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Clear, colorless liquid. |
| Specification: |
Methyl methoxyacetate , its CAS NO. is 6290-49-9, the synonyms are 4-03-00-00578 (Beilstein Handbook Reference) ; AI3-22758 ; BRN 1742944 ; CBC 108569 ; EINECS 228-539-9 ; Methoxyacetic acid, methyl ester ; Methyl 2-methoxyacetate ; NSC 61447 ; NSC 6701 ; Acetic acid, methoxy-, methyl ester . |
| Packinggroup: | III |
| HS Code: | 29189090 |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
