| Identification | |
| Name: | 1-(4-fluorophenyl)-3-(2-hydroxy-4-nitrophenyl)thiourea |
| Synonyms: | Chloroquine mustard pamoate;Chloroquine mustard, pamoate;NSC3423;NSC-3423;Quinoline, salt with 4,4'-methylenebis[3-hydroxy-2-naphthoic acid];Quinoline, compd. with 2-naphthoic acid, 4,4'-methylenebis(3-hydroxy-;2-Naphthoic acid,4'-methylenebis[3-hydroxy-, compd. with 4-[[4-[bis(2-chloroethyl)amino]-1-methylbutyl]amino]-7-chloroquinoline (1:1) |
| CAS: | 6291-53-8 |
| Molecular Formula: | C13H10FN3O3S |
| Molecular Weight: | 307.3002 |
| InChI: | InChI=1/C13H10FN3O3S/c14-8-1-3-9(4-2-8)15-13(21)16-11-6-5-10(17(19)20)7-12(11)18/h1-7,18H,(H2,15,16,21) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 225.1°C |
| Boiling Point: | 448.6°C at 760 mmHg |
| Density: | 1.598g/cm3 |
| Refractive index: | 1.781 |
| Flash Point: | 225.1°C |
| Safety Data | |
 |
|
