| Identification | |
| Name: | 4-Pyridinol,2-chloro-3-nitro- |
| Synonyms: | 2-Chloro-3-nitro-4-hydroxypyridine;2-Chloro-3-nitropyridin-4-ol; |
| CAS: | 629655-23-8 |
| Molecular Formula: | C5H3ClN2O3 |
| Molecular Weight: | 174.54 |
| InChI: | InChI=1/C5H3ClN2O3/c6-5-4(8(10)11)3(9)1-2-7-5/h1-2H,(H,7,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.664 g/cm3 |
| Refractive index: | 1.637 |
| Specification: |
The 2-Chloro-3-nitropyridin-4-ol, with CAS registry number 629655-23-8, has the systematic name of 4-pyridinol, 2-chloro-3-nitro-. And it is also called 2-Chloro-3-nitropyridin-4-ol, min. 95 %. Physical properties about this chemical are: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 5; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 78.94 Å2; (10)Index of Refraction: 1.637; (11)Molar Refractivity: 37.66 cm3; (12)Molar Volume: 104.8 cm3; (13)Polarizability: 14.93×10-24cm3; (14)Surface Tension: 74.1 dyne/cm; (15)Enthalpy of Vaporization: 68.59 kJ/mol; (16)Vapour Pressure: 3.01E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
