| Identification | |
| Name: | Cyclobutanemethanamine,1-(4-chlorophenyl)- |
| Synonyms: | 1-(4-Chlorophenyl)cyclobutanemethanamine; |
| CAS: | 63010-09-3 |
| Molecular Formula: | C11H14ClN |
| Molecular Weight: | 195.69 |
| InChI: | InChI=1/C11H14ClN/c12-10-4-2-9(3-5-10)11(8-13)6-1-7-11/h2-5H,1,6-8,13H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.149 |
| Refractive index: | 1.57 |
| Specification: |
The 1-(4-Chlorophenyl)cyclobutanemethanamine with the CAS number 63010-09-3 is also called Cyclobutanemethanamine,1-(4-chlorophenyl)-. The systematic name is 1-[1-(4-chlorophenyl)cyclobutyl]methanamine. Its molecular formula is C11H14ClN. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.27; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 2.04; (8)#H bond acceptors: 1; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 26.02 Å2; (12)Index of Refraction: 1.57; (13)Molar Refractivity: 55.92 cm3; (14)Molar Volume: 170.2 cm3; (15)Polarizability: 22.16×10-24cm3; (16)Surface Tension: 47.5 dyne/cm; (17)Enthalpy of Vaporization: 52.45 kJ/mol; (18)Vapour Pressure: 0.0028 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
