| Identification | |
| Name: | Furan,2-methyl-3-(methylthio)- |
| Synonyms: | 2-Methyl-3-methylthiofuran; |
| CAS: | 63012-97-5 |
| Molecular Formula: | C6H8OS |
| Molecular Weight: | 128.18 |
| InChI: | InChI=1/C6H8OS/c1-5-6(8-2)3-4-7-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Flash Point: | 53.1 °C |
| Boiling Point: | 164.2 °C at 760 mmHg |
| Density: | 1.08 g/cm3 |
| Refractive index: | n20/D 1.5090(lit.) |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
2-Methyl-3-(methylthio)furan , its CAS NO. is 63012-97-5, the synonyms are Furan, 2-methyl-3-(methylthio)- ; 2-Methyl-3-furlmercaptan . |
| Flash Point: | 53.1 °C |
| Safety Data | |
 |
|
