| Identification | |
| Name: | 6-Methyl-1,2,3,4-tetrahydrobenz(a)anthracene |
| Synonyms: | BRN 3280828;6-Methyl-1,2,3,4-tetrahydrobenz(a)anthracene;4-Methyl-1',2',3',4'-tetrahydro-1,2-benzanthracene;BENZ(a)ANTHRACENE, 6-METHYL-1,2,3,4-TETRAHYDRO-;AC1L2BKG;LS-27880;6-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene;3-05-00-02256 (Beilstein Handbook Reference);63020-37-1 |
| CAS: | 63020-37-1 |
| Molecular Formula: | C19H18 |
| Molecular Weight: | 246.3462 |
| InChI: | InChI=1/C19H18/c1-13-10-16-8-4-5-9-17(16)19-12-15-7-3-2-6-14(15)11-18(13)19/h2-3,6-7,10-12H,4-5,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.6°C |
| Boiling Point: | 432.8°C at 760 mmHg |
| Density: | 1.115g/cm3 |
| Refractive index: | 1.681 |
| Specification: |
6-Methyl-1,2,3,4-tetrahydrobenz(a)anthracene , its cas register number is 63020-37-1. It also can be called 3-05-00-02256 (Beilstein Handbook Reference) ; 4-Methyl-1',2',3',4'-tetrahydro-1,2-benzanthracene ; BRN 3280828 . When 6-Methyl-1,2,3,4-tetrahydrobenz(a)anthracene (CAS NO.63020-37-1) is heated to decomposition, it emits acrid smoke and irritating fumes. |
| Flash Point: | 208.6°C |
| Safety Data | |
 |
|
