| Identification | |
| Name: | 6-Isopropyl-1:2-benzanthracene |
| Synonyms: | 6-ISOPROPYL-1,2-BENZANTHRACENE;9-Isopropylbenz[a]anthracene |
| CAS: | 63020-48-4 |
| Molecular Formula: | C21H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C21H18/c1-14(2)16-8-9-17-13-21-18(12-19(17)11-16)10-7-15-5-3-4-6-20(15)21/h3-14H,1-2H3 |
| Molecular Structure: | ![(C21H18) 6-ISOPROPYL-1,2-BENZANTHRACENE;9-Isopropylbenz[a]anthracene](https://img.guidechem.com/crawlimg/63020-48-4.png) |
| Properties | |
| Flash Point: | 223.6°C |
| Boiling Point: | 455.4°C at 760 mmHg |
| Density: | 1.117g/cm3 |
| Refractive index: | 1.704 |
| Specification: |
6-Isopropyl-1:2-benzanthracene , its cas register number is 63020-48-4. It also can be called 3-05-00-02425 (Beilstein Handbook Reference) ; 9-Isopropylbenz(a)anthracene ; BRN 2525192 . When 6-Isopropyl-1:2-benzanthracene (CAS NO.63020-48-4) is heated to decomposition, it emits acrid smoke and fumes. |
| Flash Point: | 223.6°C |
| Safety Data | |
 |
|
