| Identification | |
| Name: | Butanoic acid,4-phenoxy- |
| Synonyms: | 4-Phenoxybutanoic acid;Butyricacid, 4-phenoxy- (6CI,7CI,8CI);NSC 64178;NSC 43294;4-Phenoxybutyric acid;g-Phenoxybutyric acid; |
| CAS: | 6303-58-8 |
| EINECS: | 228-603-6 |
| Molecular Formula: | C10H12O3 |
| Molecular Weight: | 180.20048 |
| InChI: | InChI=1S/C10H12O3/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.5 ºC |
| Boiling Point: | 349.6ºC at 760 mmHg |
| Density: | 1.143 g/cm3 |
| Refractive index: | 1.526 |
| Water Solubility: | ethanol: 0.1 g/mL, clear |
| Solubility: | ethanol: 0.1 g/mL, clear |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 140.5 ºC |
| Safety Data | |
 |
|
