| Identification | |
| Name: | Triphenylacrylonitrile |
| Synonyms: | Cyanotriphenylethylene |
| CAS: | 6304-33-2 |
| EINECS: | 228-610-4 |
| Molecular Formula: | C21H15N |
| Molecular Weight: | 281.35 |
| InChI: | InChI=1/C21H15N/c22-16-20(17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | 165-167°C |
| Flash Point: | 198.9°C |
| Boiling Point: | 403.2°C at 760 mmHg |
| Density: | 1.114g/cm3 |
| Refractive index: | 1.63 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Flash Point: | 198.9°C |
| Safety Data | |
 |
|
