| Identification | |
| Name: | Monoglycidyl ether of N-phenyldiethanolamine |
| Synonyms: | 2-[N-[2-[(2,3-Epoxypropan-1-yl)oxy]ethyl]anilino]ethanol |
| CAS: | 63041-07-6 |
| Molecular Formula: | C13H19NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H19NO3/c15-8-6-12-13(17-12)10-16-9-7-14-11-4-2-1-3-5-11/h1-5,12-15H,6-10H2 |
| Molecular Structure: | ![(C13H19NO3) 2-[N-[2-[(2,3-Epoxypropan-1-yl)oxy]ethyl]anilino]ethanol](https://img.guidechem.com/crawlimg/63041-07-6.png) |
| Properties | |
| Flash Point: | 207.5°C |
| Boiling Point: | 419.5°C at 760 mmHg |
| Density: | 1.165g/cm3 |
| Refractive index: | 1.567 |
| Specification: |
Monoglycidyl ether of N-phenyldiethanolamine (CAS NO.63041-07-6) is also called 2-(N-(2-(2,3-Epoxypropoxy)ethyl)anilino)ethanol ; Ethanol, 2-(N-(2-(2,3-epoxypropoxy)ethyl)anilino)- . |
| Flash Point: | 207.5°C |
| Safety Data | |
 |
|
