| Identification | |
| Name: | meso-Dihydrocholanthrene |
| Synonyms: | meso-Dihydrocholanthrene;BRN 3297417;Cholanthrene, 6,12b-dihydro-;Benz(j)aceanthrylene, 1,2,6,12b-tetrahydro-;AC1MIL40;LS-53060;1,2,6,12b-tetrahydrobenzo[j]aceanthrylene;3-05-00-02420 (Beilstein Handbook Reference);63041-49-6 |
| CAS: | 63041-49-6 |
| Molecular Formula: | C20H16 |
| Molecular Weight: | 256.341 |
| InChI: | InChI=1/C20H16/c1-2-7-16-13(4-1)8-10-17-18-11-9-14-5-3-6-15(20(14)18)12-19(16)17/h1-8,10,18H,9,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.7°C |
| Boiling Point: | 423.1°C at 760 mmHg |
| Density: | 1.197g/cm3 |
| Refractive index: | 1.71 |
| Specification: |
meso-Dihydrocholanthrene , its cas register number is 63041-49-6. It also can be called Benz(j)aceanthrylene, 1,2,6,12b-tetrahydro- ; and Cholanthrene, 6,12b-dihydro- . Its classification code is Tumor data. |
| Flash Point: | 202.7°C |
| Safety Data | |
 |
|
