Identification |
Name: | 7-Methyl-1:2:3:4-dibenzpyrene |
Synonyms: | 8-Methyldibenzo[def,p]chrysene |
CAS: | 63041-95-2 |
Molecular Formula: | C25H16 |
Molecular Weight: | 0 |
InChI: | InChI=1/C25H16/c1-15-9-12-19-18(13-15)14-17-11-10-16-5-4-8-21-20-6-2-3-7-22(20)25(19)24(17)23(16)21/h2-14H,1H3 |
Molecular Structure: |
![(C25H16) 8-Methyldibenzo[def,p]chrysene](https://img.guidechem.com/crawlimg/63041-95-2.png) |
Properties |
Flash Point: | 288.8°C |
Boiling Point: | 562.1°C at 760 mmHg |
Density: | 1.283g/cm3 |
Refractive index: | 1.881 |
Report: |
7-Methyl-1:2:3:4-dibenzpyrene (CAS NO.63041-95-2) was reported in PRLBA4 Proceedings of the Royal Society of London.
|
Flash Point: | 288.8°C |
Safety Data |
|
 |