| Identification | |
| Name: | 1-Acenaphthylenol,1,2-dihydro- |
| CAS: | 6306-07-6 |
| EINECS: | 228-618-8 |
| Molecular Formula: | C12H10 O |
| Molecular Weight: | 170.2072 |
| InChI: | InChI=1S/C12H10O/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 145-148 °C(lit.) |
| Flash Point: | 129°C |
| Boiling Point: | 369.2°C at 760 mmHg |
| Density: | 1.29g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.741 |
| Water Solubility: | almost insoluble |
| Solubility: | almost insoluble |
| Appearance: | white to cream solid |
| Specification: | white to cream solid |
| Flash Point: | 129°C |
| Safety Data | |
 |
|
