| Identification | |
| Name: | (+/-)-THREO-3-METHYLGLUTAMIC ACID |
| Synonyms: | (+/-)-THREO-3-METHYLGLUTAMIC ACID;Threo-3-Me-Glu-OH;(3S)-rel-3-Methyl-D-glutamic Acid;threo-3-Methyl-DL-glutamic Acid |
| CAS: | 63088-04-0 |
| Molecular Formula: | C6H11NO4 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C6H11NO4/c1-3(2-4(8)9)5(7)6(10)11/h3,5H,2,7H2,1H3,(H,8,9)(H,10,11)/t3-,5+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153°C |
| Boiling Point: | 329.4°C at 760 mmHg |
| Density: | 1.329g/cm3 |
| Refractive index: | 1.512 |
| Specification: | usageEng:A highly selective and potent agonist for kainate receptors. |
| Flash Point: | 153°C |
| Storage Temperature: | Store at RT |
| Usage: | A highly selective and potent agonist for kainate receptors. |
| Safety Data | |
 |
|
