| Identification | |
| Name: | Propanenitrile, 2-oxo-(9CI) |
| Synonyms: | Pyruvonitrile(6CI,7CI,8CI); 2-Oxopropanenitrile; 2-Oxopropionitrile; Acetyl cyanide; NSC91482; Pyruvic acid nitrile; a-Oxopropionitrile |
| CAS: | 631-57-2 |
| EINECS: | 211-159-2 |
| Molecular Formula: | C3H3 N O |
| Molecular Weight: | 69.06 |
| InChI: | InChI=1/C3H3NO/c1-3(5)2-4/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3273 3/PG 2 |
| Flash Point: | 58 °F |
| Boiling Point: | 92-93 °C(lit.) |
| Density: | 0.974 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.376(lit.) |
| Specification: | Safety Statements:45-61-36/37 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | II |
| Flash Point: | 58 °F |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
